peppon97 peppon97

03-07-2019
History

contestada

12. What are labor unions? What do labor unions do?

Respuesta :

theangelgamer71 theangelgamer71

03-07-2019

Answer:

labor unions are an association of people / workers and their objective is to protect their rights and interests

Explanation:

Answer Link

Otras preguntas

Answer only 59.Easy.i will announce the brainlist!!!

In a chemical reaction mass is converted what is it mean

an ice cream stand sells chocolate, vanilla, strawberry ice cream as well as a choice of 22 toppings. How many choices are there for a single flavor of ice crea

In the second stage of the french revolution, the terror, the vast majority of those executed were members of the:

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Ibrahim's blood report confirmed very low levels of cholesterol. Which process would be hampered due to this?

Factor a 3 - 3 + 3a 2 - a. (a - 1)(a + 1)(a + 3) (a2 + 1)(a - 3) (a2 - 3)(a + 1)

In the research model, the step in which the researcher specifies what he or she wants to learn about a specific topic of study is called ________

What is the purpose of having a safety lanyard onboard a personal watercraft (pwc)?

Which is a fact? A. The launch of the Hubble Space Telescope was a brilliant achievement. B. The space shuttle Columbia was a beautiful vehicle. C. The Sk